About 6-methyl-2-(methylamino)-3,8-dihydropteridine-4,7-dione
6-methyl-2-(methylamino)-3,8-dihydropteridine-4,7-dione (PubChem CID 135475051) has the molecular formula C8H9N5O2
and a molecular weight of 207.19 g/mol. Its IUPAC name is 6-methyl-2-(methylamino)-3,8-dihydropteridine-4,7-dione.
Molecular Properties
| Compound Name | 6-methyl-2-(methylamino)-3,8-dihydropteridine-4,7-dione |
| PubChem CID | 135475051 |
| Molecular Formula | C8H9N5O2 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 6-methyl-2-(methylamino)-3,8-dihydropteridine-4,7-dione |
| SMILES | CNc1nc2[nH]c(=O)c(C)nc2c(=O)[nH]1 |
| InChI | InChI=1S/C8H9N5O2/c1-3-6(14)11-5-4(10-3)7(15)13-8(9-2)12-5/h1-2H3,(H3,9,11,12,13,14,15) |
| InChIKey | SQUBCKZHFMXHPO-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-methyl-2-(methylamino)-3,8-dihydropteridine-4,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2-(methylamino)-3,8-dihydropteridine-4,7-dione?
The IUPAC name of 6-methyl-2-(methylamino)-3,8-dihydropteridine-4,7-dione (CID 135475051) is 6-methyl-2-(methylamino)-3,8-dihydropteridine-4,7-dione.
What is the SMILES notation for 6-methyl-2-(methylamino)-3,8-dihydropteridine-4,7-dione?
The canonical SMILES for 6-methyl-2-(methylamino)-3,8-dihydropteridine-4,7-dione is CNc1nc2[nH]c(=O)c(C)nc2c(=O)[nH]1.
What is the InChIKey of 6-methyl-2-(methylamino)-3,8-dihydropteridine-4,7-dione?
The InChIKey is SQUBCKZHFMXHPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N5O2/c1-3-6(14)11-5-4(10-3)7(15)13-8(9-2)12-5/h1-2H3,(H3,9,11,12,13,14,15).
What are the key properties of 6-methyl-2-(methylamino)-3,8-dihydropteridine-4,7-dione?
6-methyl-2-(methylamino)-3,8-dihydropteridine-4,7-dione has a molecular weight of 207.19 g/mol, XLogP of -0.64, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2-(methylamino)-3,8-dihydropteridine-4,7-dione is sourced from PubChem (CID 135475051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).