C13H13ClN2O — CID 135475132
5-[(2-chlorophenyl)methyl]-2,4-dimethyl-1H-pyrimidin-6-one (PubChem CID 135475132) has the molecular formula C13H13ClN2O and a molecular weight of 248.71 g/mol. Its IUPAC name is 5-[(2-chlorophenyl)methyl]-2,4-dimethyl-1H-pyrimidin-6-one.
| Compound Name | 5-[(2-chlorophenyl)methyl]-2,4-dimethyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135475132 |
| Molecular Formula | C13H13ClN2O |
| Molecular Weight | 248.71 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 5-[(2-chlorophenyl)methyl]-2,4-dimethyl-1H-pyrimidin-6-one |
| SMILES | Cc1nc(C)c(Cc2ccccc2Cl)c(=O)[nH]1 |
| InChI | InChI=1S/C13H13ClN2O/c1-8-11(13(17)16-9(2)15-8)7-10-5-3-4-6-12(10)14/h3-6H,7H2,1-2H3,(H,15,16,17) |
| InChIKey | HDVIFJKCLMTOTG-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.71 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |