C13H11ClN4O2S — CID 135475237
7-chloro-1,1-dioxo-N-(pyridin-4-ylmethyl)-4H-1λ6,2,4-benzothiadiazin-3-imine (PubChem CID 135475237) has the molecular formula C13H11ClN4O2S and a molecular weight of 322.78 g/mol. Its IUPAC name is 7-chloro-1,1-dioxo-N-(pyridin-4-ylmethyl)-4H-1λ6,2,4-benzothiadiazin-3-imine.
| Compound Name | 7-chloro-1,1-dioxo-N-(pyridin-4-ylmethyl)-4H-1λ6,2,4-benzothiadiazin-3-imine |
|---|---|
| PubChem CID | 135475237 |
| Molecular Formula | C13H11ClN4O2S |
| Molecular Weight | 322.78 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 7-chloro-1,1-dioxo-N-(pyridin-4-ylmethyl)-4H-1λ6,2,4-benzothiadiazin-3-imine |
| SMILES | O=S1(=O)N/C(=N/Cc2ccncc2)Nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C13H11ClN4O2S/c14-10-1-2-11-12(7-10)21(19,20)18-13(17-11)16-8-9-3-5-15-6-4-9/h1-7H,8H2,(H2,16,17,18) |
| InChIKey | RWRCOQUSFOVGEZ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.78 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|