C12H16IN3O2S — CID 135475240
7-iodo-N-(3-methylbutan-2-yl)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine (PubChem CID 135475240) has the molecular formula C12H16IN3O2S and a molecular weight of 393.25 g/mol. Its IUPAC name is 7-iodo-N-(3-methylbutan-2-yl)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine.
| Compound Name | 7-iodo-N-(3-methylbutan-2-yl)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine |
|---|---|
| PubChem CID | 135475240 |
| Molecular Formula | C12H16IN3O2S |
| Molecular Weight | 393.25 g/mol |
| Exact Mass | 393.00 |
| IUPAC Name | 7-iodo-N-(3-methylbutan-2-yl)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine |
| SMILES | CC(C)C(C)/N=C1\Nc2ccc(I)cc2S(=O)(=O)N1 |
| InChI | InChI=1S/C12H16IN3O2S/c1-7(2)8(3)14-12-15-10-5-4-9(13)6-11(10)19(17,18)16-12/h4-8H,1-3H3,(H2,14,15,16) |
| InChIKey | NMVRHHRSJFWXNH-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.25 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|