C23H27N3O2 — CID 135475281
ethyl 2-butylimino-4,6-diphenyl-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 135475281) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is ethyl 2-butylimino-4,6-diphenyl-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-butylimino-4,6-diphenyl-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 135475281 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | ethyl 2-butylimino-4,6-diphenyl-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCCC/N=C1\NC(c2ccccc2)=C(C(=O)OCC)C(c2ccccc2)N1 |
| InChI | InChI=1S/C23H27N3O2/c1-3-5-16-24-23-25-20(17-12-8-6-9-13-17)19(22(27)28-4-2)21(26-23)18-14-10-7-11-15-18/h6-15,20H,3-5,16H2,1-2H3,(H2,24,25,26) |
| InChIKey | KTPISLNLEKTDSO-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|