C16H12N2O — CID 135475560
2,4-diphenyl-1H-pyrimidin-6-one (PubChem CID 135475560) has the molecular formula C16H12N2O and a molecular weight of 248.29 g/mol. Its IUPAC name is 2,4-diphenyl-1H-pyrimidin-6-one.
| Compound Name | 2,4-diphenyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135475560 |
| Molecular Formula | C16H12N2O |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 2,4-diphenyl-1H-pyrimidin-6-one |
| SMILES | O=c1cc(-c2ccccc2)nc(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C16H12N2O/c19-15-11-14(12-7-3-1-4-8-12)17-16(18-15)13-9-5-2-6-10-13/h1-11H,(H,17,18,19) |
| InChIKey | XRSLJJMPKREAES-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |