C14H11Cl2FN2O5 — CID 135475707
methyl (E)-2-(cyclopropyliminomethyl)-3-(2,4-dichloro-5-fluoro-3-nitrophenyl)-3-hydroxyprop-2-enoate (PubChem CID 135475707) has the molecular formula C14H11Cl2FN2O5 and a molecular weight of 377.16 g/mol. Its IUPAC name is methyl (E)-2-(cyclopropyliminomethyl)-3-(2,4-dichloro-5-fluoro-3-nitrophenyl)-3-hydroxyprop-2-enoate.
| Compound Name | methyl (E)-2-(cyclopropyliminomethyl)-3-(2,4-dichloro-5-fluoro-3-nitrophenyl)-3-hydroxyprop-2-enoate |
|---|---|
| PubChem CID | 135475707 |
| Molecular Formula | C14H11Cl2FN2O5 |
| Molecular Weight | 377.16 g/mol |
| Exact Mass | 376.00 |
| IUPAC Name | methyl (E)-2-(cyclopropyliminomethyl)-3-(2,4-dichloro-5-fluoro-3-nitrophenyl)-3-hydroxyprop-2-enoate |
| SMILES | COC(=O)C(/C=N/C1CC1)=C(/O)c1cc(F)c(Cl)c([N+](=O)[O-])c1Cl |
| InChI | InChI=1S/C14H11Cl2FN2O5/c1-24-14(21)8(5-18-6-2-3-6)13(20)7-4-9(17)11(16)12(10(7)15)19(22)23/h4-6,20H,2-3H2,1H3/b13-8+,18-5+ |
| InChIKey | FQDPKADFSVBMNN-BNKQILTNSA-N |
| XLogP | 3.72 |
| TPSA | 102.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.16 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|