About 5-[2-(2-chlorophenyl)pyrazol-3-yl]-N,N-diethyl-2,4-dihydroxybenzenesulfonamide
5-[2-(2-chlorophenyl)pyrazol-3-yl]-N,N-diethyl-2,4-dihydroxybenzenesulfonamide (PubChem CID 135475942) has the molecular formula C19H20ClN3O4S
and a molecular weight of 421.91 g/mol. Its IUPAC name is 5-[2-(2-chlorophenyl)pyrazol-3-yl]-N,N-diethyl-2,4-dihydroxybenzenesulfonamide.
Molecular Properties
| Compound Name | 5-[2-(2-chlorophenyl)pyrazol-3-yl]-N,N-diethyl-2,4-dihydroxybenzenesulfonamide |
| PubChem CID | 135475942 |
| Molecular Formula | C19H20ClN3O4S |
| Molecular Weight | 421.91 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | 5-[2-(2-chlorophenyl)pyrazol-3-yl]-N,N-diethyl-2,4-dihydroxybenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(-c2ccnn2-c2ccccc2Cl)c(O)cc1O |
| InChI | InChI=1S/C19H20ClN3O4S/c1-3-22(4-2)28(26,27)19-11-13(17(24)12-18(19)25)15-9-10-21-23(15)16-8-6-5-7-14(16)20/h5-12,24-25H,3-4H2,1-2H3 |
| InChIKey | XCYUUFFFLGNGKB-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.91 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[2-(2-chlorophenyl)pyrazol-3-yl]-N,N-diethyl-2,4-dihydroxybenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(2-chlorophenyl)pyrazol-3-yl]-N,N-diethyl-2,4-dihydroxybenzenesulfonamide?
The IUPAC name of 5-[2-(2-chlorophenyl)pyrazol-3-yl]-N,N-diethyl-2,4-dihydroxybenzenesulfonamide (CID 135475942) is 5-[2-(2-chlorophenyl)pyrazol-3-yl]-N,N-diethyl-2,4-dihydroxybenzenesulfonamide.
What is the SMILES notation for 5-[2-(2-chlorophenyl)pyrazol-3-yl]-N,N-diethyl-2,4-dihydroxybenzenesulfonamide?
The canonical SMILES for 5-[2-(2-chlorophenyl)pyrazol-3-yl]-N,N-diethyl-2,4-dihydroxybenzenesulfonamide is CCN(CC)S(=O)(=O)c1cc(-c2ccnn2-c2ccccc2Cl)c(O)cc1O.
What is the InChIKey of 5-[2-(2-chlorophenyl)pyrazol-3-yl]-N,N-diethyl-2,4-dihydroxybenzenesulfonamide?
The InChIKey is XCYUUFFFLGNGKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20ClN3O4S/c1-3-22(4-2)28(26,27)19-11-13(17(24)12-18(19)25)15-9-10-21-23(15)16-8-6-5-7-14(16)20/h5-12,24-25H,3-4H2,1-2H3.
What are the key properties of 5-[2-(2-chlorophenyl)pyrazol-3-yl]-N,N-diethyl-2,4-dihydroxybenzenesulfonamide?
5-[2-(2-chlorophenyl)pyrazol-3-yl]-N,N-diethyl-2,4-dihydroxybenzenesulfonamide has a molecular weight of 421.91 g/mol, XLogP of 3.63, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(2-chlorophenyl)pyrazol-3-yl]-N,N-diethyl-2,4-dihydroxybenzenesulfonamide is sourced from PubChem (CID 135475942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).