C35H28N4O3 — CID 135475996
5-phenyl-15-(3,4,5-trimethoxyphenyl)-21,23-dihydroporphyrin (PubChem CID 135475996) has the molecular formula C35H28N4O3 and a molecular weight of 552.63 g/mol. Its IUPAC name is 5-phenyl-15-(3,4,5-trimethoxyphenyl)-21,23-dihydroporphyrin.
| Compound Name | 5-phenyl-15-(3,4,5-trimethoxyphenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 135475996 |
| Molecular Formula | C35H28N4O3 |
| Molecular Weight | 552.63 g/mol |
| Exact Mass | 552.22 |
| IUPAC Name | 5-phenyl-15-(3,4,5-trimethoxyphenyl)-21,23-dihydroporphyrin |
| SMILES | COc1cc(-c2c3nc(cc4ccc([nH]4)c(-c4ccccc4)c4nc(cc5ccc2[nH]5)C=C4)C=C3)cc(OC)c1OC |
| InChI | InChI=1S/C35H28N4O3/c1-40-31-17-22(18-32(41-2)35(31)42-3)34-29-15-11-25(38-29)19-23-9-13-27(36-23)33(21-7-5-4-6-8-21)28-14-10-24(37-28)20-26-12-16-30(34)39-26/h4-20,36,39H,1-3H3/b23-19-,24-20-,25-19-,26-20-,33-27-,33-28-,34-29-,34-30- |
| InChIKey | YGKXVGYSJQYPSJ-SZIPMURYSA-N |
| XLogP | 8.02 |
| TPSA | 85.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.63 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |