C17H21N5O4 — CID 135476159
2-amino-5-[(3,4,5-trimethoxy-N-methylanilino)methyl]-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one (PubChem CID 135476159) has the molecular formula C17H21N5O4 and a molecular weight of 359.39 g/mol. Its IUPAC name is 2-amino-5-[(3,4,5-trimethoxy-N-methylanilino)methyl]-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-amino-5-[(3,4,5-trimethoxy-N-methylanilino)methyl]-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135476159 |
| Molecular Formula | C17H21N5O4 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 2-amino-5-[(3,4,5-trimethoxy-N-methylanilino)methyl]-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one |
| SMILES | COc1cc(N(C)Cc2c[nH]c3nc(N)[nH]c(=O)c23)cc(OC)c1OC |
| InChI | InChI=1S/C17H21N5O4/c1-22(10-5-11(24-2)14(26-4)12(6-10)25-3)8-9-7-19-15-13(9)16(23)21-17(18)20-15/h5-7H,8H2,1-4H3,(H4,18,19,20,21,23) |
| InChIKey | SYEFVJGLOMHTOL-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 118.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|