C16H18N4O5 — CID 135476496
1-(1,3-benzodioxol-5-yl)-3-butyl-4-hydroxy-2,6-dioxopyrimidine-5-carboximidamide (PubChem CID 135476496) has the molecular formula C16H18N4O5 and a molecular weight of 346.34 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-butyl-4-hydroxy-2,6-dioxopyrimidine-5-carboximidamide.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-butyl-4-hydroxy-2,6-dioxopyrimidine-5-carboximidamide |
|---|---|
| PubChem CID | 135476496 |
| Molecular Formula | C16H18N4O5 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-butyl-4-hydroxy-2,6-dioxopyrimidine-5-carboximidamide |
| SMILES | [H]/N=C(\N)c1c(O)n(CCCC)c(=O)n(-c2ccc3c(c2)OCO3)c1=O |
| InChI | InChI=1S/C16H18N4O5/c1-2-3-6-19-14(21)12(13(17)18)15(22)20(16(19)23)9-4-5-10-11(7-9)25-8-24-10/h4-5,7,21H,2-3,6,8H2,1H3,(H3,17,18) |
| InChIKey | LPOOFSBBJLCGHR-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 132.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|