C38H33IN4O — CID 135476629
20-iodo-3,3-dimethyl-10-(4-methylphenyl)-15-(2,4,6-trimethylphenyl)-21H-porphyrin-2-ol (PubChem CID 135476629) has the molecular formula C38H33IN4O and a molecular weight of 688.61 g/mol. Its IUPAC name is 20-iodo-3,3-dimethyl-10-(4-methylphenyl)-15-(2,4,6-trimethylphenyl)-21H-porphyrin-2-ol.
| Compound Name | 20-iodo-3,3-dimethyl-10-(4-methylphenyl)-15-(2,4,6-trimethylphenyl)-21H-porphyrin-2-ol |
|---|---|
| PubChem CID | 135476629 |
| Molecular Formula | C38H33IN4O |
| Molecular Weight | 688.61 g/mol |
| Exact Mass | 688.17 |
| IUPAC Name | 20-iodo-3,3-dimethyl-10-(4-methylphenyl)-15-(2,4,6-trimethylphenyl)-21H-porphyrin-2-ol |
| SMILES | Cc1ccc(/C2=C3\C=CC(=N3)/C=C3\NC(=C(O)C3(C)C)/C(I)=C3/C=CC(=N3)/C(c3c(C)cc(C)cc3C)=C3/C=CC2=N3)cc1 |
| InChI | InChI=1S/C38H33IN4O/c1-20-7-9-24(10-8-20)33-26-12-11-25(40-26)19-31-38(5,6)37(44)36(43-31)35(39)30-16-15-29(42-30)34(28-14-13-27(33)41-28)32-22(3)17-21(2)18-23(32)4/h7-19,43-44H,1-6H3/b31-19-,33-26-,34-28+,35-30+ |
| InChIKey | PZFJQXOPZPJZFJ-PDTGHKLWSA-N |
| XLogP | 9.02 |
| TPSA | 69.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.61 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|