C52H46N4O4 — CID 135476644
5,10,15,20-tetrakis(4-ethoxyphenyl)-21,23-dihydroporphyrin (PubChem CID 135476644) has the molecular formula C52H46N4O4 and a molecular weight of 790.96 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(4-ethoxyphenyl)-21,23-dihydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis(4-ethoxyphenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 135476644 |
| Molecular Formula | C52H46N4O4 |
| Molecular Weight | 790.96 g/mol |
| Exact Mass | 790.35 |
| IUPAC Name | 5,10,15,20-tetrakis(4-ethoxyphenyl)-21,23-dihydroporphyrin |
| SMILES | CCOc1ccc(-c2c3nc(c(-c4ccc(OCC)cc4)c4ccc([nH]4)c(-c4ccc(OCC)cc4)c4nc(c(-c5ccc(OCC)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C52H46N4O4/c1-5-57-37-17-9-33(10-18-37)49-41-25-27-43(53-41)50(34-11-19-38(20-12-34)58-6-2)45-29-31-47(55-45)52(36-15-23-40(24-16-36)60-8-4)48-32-30-46(56-48)51(44-28-26-42(49)54-44)35-13-21-39(22-14-35)59-7-3/h9-32,53,56H,5-8H2,1-4H3/b49-41-,49-42-,50-43-,50-45-,51-44-,51-46-,52-47-,52-48- |
| InChIKey | RPIIEPQBFDFIOA-RCOMQYLTSA-N |
| XLogP | 12.92 |
| TPSA | 94.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.96 |
| LogP ≤ 5 | 12.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |