C18H21FN4OS — CID 135476676
N-(2-fluorophenyl)-5-[1-(2-methoxyethyl)-2,5-dimethylpyrrol-3-yl]-3,6-dihydro-1,3,4-thiadiazin-2-imine (PubChem CID 135476676) has the molecular formula C18H21FN4OS and a molecular weight of 360.46 g/mol. Its IUPAC name is N-(2-fluorophenyl)-5-[1-(2-methoxyethyl)-2,5-dimethylpyrrol-3-yl]-3,6-dihydro-1,3,4-thiadiazin-2-imine.
| Compound Name | N-(2-fluorophenyl)-5-[1-(2-methoxyethyl)-2,5-dimethylpyrrol-3-yl]-3,6-dihydro-1,3,4-thiadiazin-2-imine |
|---|---|
| PubChem CID | 135476676 |
| Molecular Formula | C18H21FN4OS |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | N-(2-fluorophenyl)-5-[1-(2-methoxyethyl)-2,5-dimethylpyrrol-3-yl]-3,6-dihydro-1,3,4-thiadiazin-2-imine |
| SMILES | COCCn1c(C)cc(C2=NN/C(=N/c3ccccc3F)SC2)c1C |
| InChI | InChI=1S/C18H21FN4OS/c1-12-10-14(13(2)23(12)8-9-24-3)17-11-25-18(22-21-17)20-16-7-5-4-6-15(16)19/h4-7,10H,8-9,11H2,1-3H3,(H,20,22) |
| InChIKey | DHXSHESWLZVTEU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 50.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_urea_L(1)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|