About [(E)-(3,4-dihydroxyphenyl)methylideneamino]-trimethylazanium iodide
[(E)-(3,4-dihydroxyphenyl)methylideneamino]-trimethylazanium iodide (PubChem CID 135476761) has the molecular formula C10H15IN2O2
and a molecular weight of 322.15 g/mol. Its IUPAC name is [(E)-(3,4-dihydroxyphenyl)methylideneamino]-trimethylazanium iodide.
Molecular Properties
| Compound Name | [(E)-(3,4-dihydroxyphenyl)methylideneamino]-trimethylazanium iodide |
| PubChem CID | 135476761 |
| Molecular Formula | C10H15IN2O2 |
| Molecular Weight | 322.15 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | [(E)-(3,4-dihydroxyphenyl)methylideneamino]-trimethylazanium iodide |
| SMILES | C[N+](C)(C)/N=C/c1ccc(O)c(O)c1.[I-] |
| InChI | InChI=1S/C10H14N2O2.HI/c1-12(2,3)11-7-8-4-5-9(13)10(14)6-8;/h4-7H,1-3H3,(H-,11,13,14);1H |
| InChIKey | RCBFYNUXDDIGSO-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.15 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [(E)-(3,4-dihydroxyphenyl)methylideneamino]-trimethylazanium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-(3,4-dihydroxyphenyl)methylideneamino]-trimethylazanium iodide?
The IUPAC name of [(E)-(3,4-dihydroxyphenyl)methylideneamino]-trimethylazanium iodide (CID 135476761) is [(E)-(3,4-dihydroxyphenyl)methylideneamino]-trimethylazanium iodide.
What is the SMILES notation for [(E)-(3,4-dihydroxyphenyl)methylideneamino]-trimethylazanium iodide?
The canonical SMILES for [(E)-(3,4-dihydroxyphenyl)methylideneamino]-trimethylazanium iodide is C[N+](C)(C)/N=C/c1ccc(O)c(O)c1.[I-].
What is the InChIKey of [(E)-(3,4-dihydroxyphenyl)methylideneamino]-trimethylazanium iodide?
The InChIKey is RCBFYNUXDDIGSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O2.HI/c1-12(2,3)11-7-8-4-5-9(13)10(14)6-8;/h4-7H,1-3H3,(H-,11,13,14);1H.
What are the key properties of [(E)-(3,4-dihydroxyphenyl)methylideneamino]-trimethylazanium iodide?
[(E)-(3,4-dihydroxyphenyl)methylideneamino]-trimethylazanium iodide has a molecular weight of 322.15 g/mol, XLogP of -1.86, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-(3,4-dihydroxyphenyl)methylideneamino]-trimethylazanium iodide is sourced from PubChem (CID 135476761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).