C16H13Cl4N3O3 — CID 135476845
1-[(2,6-dichlorophenyl)methoxy]-3-[(E)-(2,4-dichlorophenyl)methoxyiminomethyl]urea (PubChem CID 135476845) has the molecular formula C16H13Cl4N3O3 and a molecular weight of 437.11 g/mol. Its IUPAC name is 1-[(2,6-dichlorophenyl)methoxy]-3-[(E)-(2,4-dichlorophenyl)methoxyiminomethyl]urea.
| Compound Name | 1-[(2,6-dichlorophenyl)methoxy]-3-[(E)-(2,4-dichlorophenyl)methoxyiminomethyl]urea |
|---|---|
| PubChem CID | 135476845 |
| Molecular Formula | C16H13Cl4N3O3 |
| Molecular Weight | 437.11 g/mol |
| Exact Mass | 434.97 |
| IUPAC Name | 1-[(2,6-dichlorophenyl)methoxy]-3-[(E)-(2,4-dichlorophenyl)methoxyiminomethyl]urea |
| SMILES | O=C(N/C=N/OCc1ccc(Cl)cc1Cl)NOCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H13Cl4N3O3/c17-11-5-4-10(15(20)6-11)7-25-22-9-21-16(24)23-26-8-12-13(18)2-1-3-14(12)19/h1-6,9H,7-8H2,(H2,21,22,23,24) |
| InChIKey | XMFZRFUHINORMI-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.11 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|