C16H14BrN3O2S — CID 135477009
5-(2-bromophenyl)-2-prop-2-enylsulfanyl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione (PubChem CID 135477009) has the molecular formula C16H14BrN3O2S and a molecular weight of 392.28 g/mol. Its IUPAC name is 5-(2-bromophenyl)-2-prop-2-enylsulfanyl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione.
| Compound Name | 5-(2-bromophenyl)-2-prop-2-enylsulfanyl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 135477009 |
| Molecular Formula | C16H14BrN3O2S |
| Molecular Weight | 392.28 g/mol |
| Exact Mass | 391.00 |
| IUPAC Name | 5-(2-bromophenyl)-2-prop-2-enylsulfanyl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
| SMILES | C=CCSc1nc2c(c(=O)[nH]1)C(c1ccccc1Br)CC(=O)N2 |
| InChI | InChI=1S/C16H14BrN3O2S/c1-2-7-23-16-19-14-13(15(22)20-16)10(8-12(21)18-14)9-5-3-4-6-11(9)17/h2-6,10H,1,7-8H2,(H2,18,19,20,21,22) |
| InChIKey | JEWGQHPFGKDQDN-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.28 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|