C21H18F2N6O3S — CID 135477801
7-[5-[(3,5-difluorophenyl)methyl]-1H-1,2,4-triazol-3-yl]-5-(1,1-dioxothiazinan-2-yl)-1,6-naphthyridin-8-ol (PubChem CID 135477801) has the molecular formula C21H18F2N6O3S and a molecular weight of 472.48 g/mol. Its IUPAC name is 7-[5-[(3,5-difluorophenyl)methyl]-1H-1,2,4-triazol-3-yl]-5-(1,1-dioxothiazinan-2-yl)-1,6-naphthyridin-8-ol.
| Compound Name | 7-[5-[(3,5-difluorophenyl)methyl]-1H-1,2,4-triazol-3-yl]-5-(1,1-dioxothiazinan-2-yl)-1,6-naphthyridin-8-ol |
|---|---|
| PubChem CID | 135477801 |
| Molecular Formula | C21H18F2N6O3S |
| Molecular Weight | 472.48 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | 7-[5-[(3,5-difluorophenyl)methyl]-1H-1,2,4-triazol-3-yl]-5-(1,1-dioxothiazinan-2-yl)-1,6-naphthyridin-8-ol |
| SMILES | O=S1(=O)CCCCN1c1nc(-c2n[nH]c(Cc3cc(F)cc(F)c3)n2)c(O)c2ncccc12 |
| InChI | InChI=1S/C21H18F2N6O3S/c22-13-8-12(9-14(23)11-13)10-16-25-20(28-27-16)18-19(30)17-15(4-3-5-24-17)21(26-18)29-6-1-2-7-33(29,31)32/h3-5,8-9,11,30H,1-2,6-7,10H2,(H,25,27,28) |
| InChIKey | VZVVGBMBTHYLBI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.48 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |