C15H16N4O5 — CID 135477941
3-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1,4(13),5,8,11-pentaen-10-one (PubChem CID 135477941) has the molecular formula C15H16N4O5 and a molecular weight of 332.32 g/mol. Its IUPAC name is 3-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1,4(13),5,8,11-pentaen-10-one.
| Compound Name | 3-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1,4(13),5,8,11-pentaen-10-one |
|---|---|
| PubChem CID | 135477941 |
| Molecular Formula | C15H16N4O5 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 3-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1,4(13),5,8,11-pentaen-10-one |
| SMILES | CO[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1n1cc2ccc(=O)nc3c2c1N=CN3 |
| InChI | InChI=1S/C15H16N4O5/c1-23-12-11(22)8(5-20)24-15(12)19-4-7-2-3-9(21)18-13-10(7)14(19)17-6-16-13/h2-4,6,8,11-12,15,20,22H,5H2,1H3,(H,16,17,18,21)/t8-,11-,12-,15-/m1/s1 |
| InChIKey | CLUVFNYWAFPDBX-PMXXHBEXSA-N |
| XLogP | -0.25 |
| TPSA | 118.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |