C13H18N2O3 — CID 135478287
3-(1,3,4,5-tetrahydro-1-benzazepin-2-ylideneamino)propanoic acid;hydrate (PubChem CID 135478287) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is 3-(1,3,4,5-tetrahydro-1-benzazepin-2-ylideneamino)propanoic acid;hydrate.
| Compound Name | 3-(1,3,4,5-tetrahydro-1-benzazepin-2-ylideneamino)propanoic acid;hydrate |
|---|---|
| PubChem CID | 135478287 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 3-(1,3,4,5-tetrahydro-1-benzazepin-2-ylideneamino)propanoic acid;hydrate |
| SMILES | O.O=C(O)CC/N=C1\CCCc2ccccc2N1 |
| InChI | InChI=1S/C13H16N2O2.H2O/c16-13(17)8-9-14-12-7-3-5-10-4-1-2-6-11(10)15-12;/h1-2,4,6H,3,5,7-9H2,(H,14,15)(H,16,17);1H2 |
| InChIKey | CTDGZGGSOJJRLW-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|