C11H19N5O2 — CID 135478738
ethyl 5-[(E)-[butyl(methyl)amino]diazenyl]-1H-pyrazole-4-carboxylate (PubChem CID 135478738) has the molecular formula C11H19N5O2 and a molecular weight of 253.31 g/mol. Its IUPAC name is ethyl 5-[(E)-[butyl(methyl)amino]diazenyl]-1H-pyrazole-4-carboxylate.
| Compound Name | ethyl 5-[(E)-[butyl(methyl)amino]diazenyl]-1H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 135478738 |
| Molecular Formula | C11H19N5O2 |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | ethyl 5-[(E)-[butyl(methyl)amino]diazenyl]-1H-pyrazole-4-carboxylate |
| SMILES | CCCCN(C)/N=N/c1[nH]ncc1C(=O)OCC |
| InChI | InChI=1S/C11H19N5O2/c1-4-6-7-16(3)15-14-10-9(8-12-13-10)11(17)18-5-2/h8H,4-7H2,1-3H3,(H,12,13)/b15-14+ |
| InChIKey | CWYXGQNFQVKDRZ-CCEZHUSRSA-N |
| XLogP | 2.32 |
| TPSA | 82.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|