About 3-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one
3-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 135478830) has the molecular formula C10H6Cl2N2O2S2
and a molecular weight of 321.21 g/mol. Its IUPAC name is 3-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 3-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one |
| PubChem CID | 135478830 |
| Molecular Formula | C10H6Cl2N2O2S2 |
| Molecular Weight | 321.21 g/mol |
| Exact Mass | 319.92 |
| IUPAC Name | 3-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(=S)N1/N=C/c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C10H6Cl2N2O2S2/c11-6-1-5(9(16)7(12)2-6)3-13-14-8(15)4-18-10(14)17/h1-3,16H,4H2/b13-3+ |
| InChIKey | OQQGCUKLWVHEBC-QLKAYGNNSA-N |
| XLogP | 2.89 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.21 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one?
The IUPAC name of 3-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one (CID 135478830) is 3-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one.
What is the SMILES notation for 3-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one?
The canonical SMILES for 3-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one is O=C1CSC(=S)N1/N=C/c1cc(Cl)cc(Cl)c1O.
What is the InChIKey of 3-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one?
The InChIKey is OQQGCUKLWVHEBC-QLKAYGNNSA-N. The full InChI is InChI=1S/C10H6Cl2N2O2S2/c11-6-1-5(9(16)7(12)2-6)3-13-14-8(15)4-18-10(14)17/h1-3,16H,4H2/b13-3+.
What are the key properties of 3-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one?
3-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one has a molecular weight of 321.21 g/mol, XLogP of 2.89, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one is sourced from PubChem (CID 135478830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).