About 3-(1H-1,2,4-triazol-5-yl)-4H-oxatriazol-3-ium-5-one
3-(1H-1,2,4-triazol-5-yl)-4H-oxatriazol-3-ium-5-one (PubChem CID 135479511) has the molecular formula C3H3N6O2+
and a molecular weight of 155.10 g/mol. Its IUPAC name is 3-(1H-1,2,4-triazol-5-yl)-4H-oxatriazol-3-ium-5-one.
Molecular Properties
| Compound Name | 3-(1H-1,2,4-triazol-5-yl)-4H-oxatriazol-3-ium-5-one |
| PubChem CID | 135479511 |
| Molecular Formula | C3H3N6O2+ |
| Molecular Weight | 155.10 g/mol |
| Exact Mass | 155.03 |
| IUPAC Name | 3-(1H-1,2,4-triazol-5-yl)-4H-oxatriazol-3-ium-5-one |
| SMILES | O=c1[nH][n+](-c2ncn[nH]2)no1 |
| InChI | InChI=1S/C3H2N6O2/c10-3-7-9(8-11-3)2-4-1-5-6-2/h1H,(H-,4,5,6,7,8,10)/p+1 |
| InChIKey | ZHAUZUGVGDLFPG-UHFFFAOYSA-O |
| XLogP | -2.24 |
| TPSA | 104.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.10 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(1H-1,2,4-triazol-5-yl)-4H-oxatriazol-3-ium-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1H-1,2,4-triazol-5-yl)-4H-oxatriazol-3-ium-5-one?
The IUPAC name of 3-(1H-1,2,4-triazol-5-yl)-4H-oxatriazol-3-ium-5-one (CID 135479511) is 3-(1H-1,2,4-triazol-5-yl)-4H-oxatriazol-3-ium-5-one.
What is the SMILES notation for 3-(1H-1,2,4-triazol-5-yl)-4H-oxatriazol-3-ium-5-one?
The canonical SMILES for 3-(1H-1,2,4-triazol-5-yl)-4H-oxatriazol-3-ium-5-one is O=c1[nH][n+](-c2ncn[nH]2)no1.
What is the InChIKey of 3-(1H-1,2,4-triazol-5-yl)-4H-oxatriazol-3-ium-5-one?
The InChIKey is ZHAUZUGVGDLFPG-UHFFFAOYSA-O. The full InChI is InChI=1S/C3H2N6O2/c10-3-7-9(8-11-3)2-4-1-5-6-2/h1H,(H-,4,5,6,7,8,10)/p+1.
What are the key properties of 3-(1H-1,2,4-triazol-5-yl)-4H-oxatriazol-3-ium-5-one?
3-(1H-1,2,4-triazol-5-yl)-4H-oxatriazol-3-ium-5-one has a molecular weight of 155.10 g/mol, XLogP of -2.24, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1H-1,2,4-triazol-5-yl)-4H-oxatriazol-3-ium-5-one is sourced from PubChem (CID 135479511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).