C16H14I2N2O3 — CID 135479567
N-[(E)-(2-hydroxy-3,5-diiodophenyl)methylideneamino]-2-(4-methylphenoxy)acetamide (PubChem CID 135479567) has the molecular formula C16H14I2N2O3 and a molecular weight of 536.11 g/mol. Its IUPAC name is N-[(E)-(2-hydroxy-3,5-diiodophenyl)methylideneamino]-2-(4-methylphenoxy)acetamide.
| Compound Name | N-[(E)-(2-hydroxy-3,5-diiodophenyl)methylideneamino]-2-(4-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 135479567 |
| Molecular Formula | C16H14I2N2O3 |
| Molecular Weight | 536.11 g/mol |
| Exact Mass | 535.91 |
| IUPAC Name | N-[(E)-(2-hydroxy-3,5-diiodophenyl)methylideneamino]-2-(4-methylphenoxy)acetamide |
| SMILES | Cc1ccc(OCC(=O)N/N=C/c2cc(I)cc(I)c2O)cc1 |
| InChI | InChI=1S/C16H14I2N2O3/c1-10-2-4-13(5-3-10)23-9-15(21)20-19-8-11-6-12(17)7-14(18)16(11)22/h2-8,22H,9H2,1H3,(H,20,21)/b19-8+ |
| InChIKey | HOFFLUAKDDATJQ-UFWORHAWSA-N |
| XLogP | 3.44 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.11 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|