C13H8F3N7O3 — CID 135479859
2-nitro-6-[(E)-[[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]hydrazinylidene]methyl]phenol (PubChem CID 135479859) has the molecular formula C13H8F3N7O3 and a molecular weight of 367.25 g/mol. Its IUPAC name is 2-nitro-6-[(E)-[[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]hydrazinylidene]methyl]phenol.
| Compound Name | 2-nitro-6-[(E)-[[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 135479859 |
| Molecular Formula | C13H8F3N7O3 |
| Molecular Weight | 367.25 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | 2-nitro-6-[(E)-[[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]hydrazinylidene]methyl]phenol |
| SMILES | O=[N+]([O-])c1cccc(/C=N/Nc2ccc3nnc(C(F)(F)F)n3n2)c1O |
| InChI | InChI=1S/C13H8F3N7O3/c14-13(15,16)12-20-19-10-5-4-9(21-22(10)12)18-17-6-7-2-1-3-8(11(7)24)23(25)26/h1-6,24H,(H,18,21)/b17-6+ |
| InChIKey | DPXGUHGQKDAQQN-UBKPWBPPSA-N |
| XLogP | 2.20 |
| TPSA | 130.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.25 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|