C41H27N7 — CID 135480005
5-phenyl-10,15,20-tripyridin-4-yl-21,23-dihydroporphyrin (PubChem CID 135480005) has the molecular formula C41H27N7 and a molecular weight of 617.72 g/mol. Its IUPAC name is 5-phenyl-10,15,20-tripyridin-4-yl-21,23-dihydroporphyrin.
| Compound Name | 5-phenyl-10,15,20-tripyridin-4-yl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 135480005 |
| Molecular Formula | C41H27N7 |
| Molecular Weight | 617.72 g/mol |
| Exact Mass | 617.23 |
| IUPAC Name | 5-phenyl-10,15,20-tripyridin-4-yl-21,23-dihydroporphyrin |
| SMILES | C1=Cc2nc1c(-c1ccccc1)c1ccc([nH]1)c(-c1ccncc1)c1nc(c(-c3ccncc3)c3ccc([nH]3)c2-c2ccncc2)C=C1 |
| InChI | InChI=1S/C41H27N7/c1-2-4-26(5-3-1)38-30-6-8-32(45-30)39(27-14-20-42-21-15-27)34-10-12-36(47-34)41(29-18-24-44-25-19-29)37-13-11-35(48-37)40(28-16-22-43-23-17-28)33-9-7-31(38)46-33/h1-25,45,48H/b38-30-,38-31-,39-32-,39-34-,40-33-,40-35-,41-36-,41-37- |
| InChIKey | CEUIUXQCTUYZHH-NOAYMEMSSA-N |
| XLogP | 9.51 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.72 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |