C17H17Br2N3O4 — CID 135480208
ethyl 2-[4-[[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]carbamoyl]pyridin-1-ium-1-yl]acetate bromide (PubChem CID 135480208) has the molecular formula C17H17Br2N3O4 and a molecular weight of 487.15 g/mol. Its IUPAC name is ethyl 2-[4-[[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]carbamoyl]pyridin-1-ium-1-yl]acetate bromide.
| Compound Name | ethyl 2-[4-[[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]carbamoyl]pyridin-1-ium-1-yl]acetate bromide |
|---|---|
| PubChem CID | 135480208 |
| Molecular Formula | C17H17Br2N3O4 |
| Molecular Weight | 487.15 g/mol |
| Exact Mass | 484.96 |
| IUPAC Name | ethyl 2-[4-[[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]carbamoyl]pyridin-1-ium-1-yl]acetate bromide |
| SMILES | CCOC(=O)C[n+]1ccc(C(=O)N/N=C/c2cc(Br)ccc2O)cc1.[Br-] |
| InChI | InChI=1S/C17H16BrN3O4.BrH/c1-2-25-16(23)11-21-7-5-12(6-8-21)17(24)20-19-10-13-9-14(18)3-4-15(13)22;/h3-10,24H,2,11H2,1H3;1H |
| InChIKey | UUFUDDCOAMYUSE-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 91.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.15 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|