C44H19Cl6F5N4 — CID 135480344
5,10,15-tris(2,6-dichlorophenyl)-20-(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin (PubChem CID 135480344) has the molecular formula C44H19Cl6F5N4 and a molecular weight of 911.37 g/mol. Its IUPAC name is 5,10,15-tris(2,6-dichlorophenyl)-20-(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin.
| Compound Name | 5,10,15-tris(2,6-dichlorophenyl)-20-(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 135480344 |
| Molecular Formula | C44H19Cl6F5N4 |
| Molecular Weight | 911.37 g/mol |
| Exact Mass | 907.97 |
| IUPAC Name | 5,10,15-tris(2,6-dichlorophenyl)-20-(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin |
| SMILES | Fc1c(F)c(F)c(-c2c3nc(c(-c4c(Cl)cccc4Cl)c4ccc([nH]4)c(-c4c(Cl)cccc4Cl)c4nc(c(-c5c(Cl)cccc5Cl)c5ccc2[nH]5)C=C4)C=C3)c(F)c1F |
| InChI | InChI=1S/C44H19Cl6F5N4/c45-18-4-1-5-19(46)32(18)35-24-10-12-26(56-24)36(33-20(47)6-2-7-21(33)48)28-14-16-30(58-28)38(39-40(51)42(53)44(55)43(54)41(39)52)31-17-15-29(59-31)37(27-13-11-25(35)57-27)34-22(49)8-3-9-23(34)50/h1-17,56,59H/b35-24+,35-25+,36-26+,36-28+,37-27+,37-29+,38-30+,38-31+ |
| InChIKey | FFTGUNPMNCCSAS-DORMHRIJSA-N |
| XLogP | 15.94 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 911.37 |
| LogP ≤ 5 | 15.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|