C29H47N7O7S — CID 135480418
2-[1-[(2S)-2-[(3,3-dimethyl-2,4-dihydro-1H-quinolin-8-yl)sulfonylamino]-5-[[(E)-N'-nitrocarbamimidoyl]amino]pentanoyl]piperidin-4-yl]ethyl 2,2-dimethylpropanoate (PubChem CID 135480418) has the molecular formula C29H47N7O7S and a molecular weight of 637.80 g/mol. Its IUPAC name is 2-[1-[(2S)-2-[(3,3-dimethyl-2,4-dihydro-1H-quinolin-8-yl)sulfonylamino]-5-[[(E)-N'-nitrocarbamimidoyl]amino]pentanoyl]piperidin-4-yl]ethyl 2,2-dimethylpropanoate.
| Compound Name | 2-[1-[(2S)-2-[(3,3-dimethyl-2,4-dihydro-1H-quinolin-8-yl)sulfonylamino]-5-[[(E)-N'-nitrocarbamimidoyl]amino]pentanoyl]piperidin-4-yl]ethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 135480418 |
| Molecular Formula | C29H47N7O7S |
| Molecular Weight | 637.80 g/mol |
| Exact Mass | 637.33 |
| IUPAC Name | 2-[1-[(2S)-2-[(3,3-dimethyl-2,4-dihydro-1H-quinolin-8-yl)sulfonylamino]-5-[[(E)-N'-nitrocarbamimidoyl]amino]pentanoyl]piperidin-4-yl]ethyl 2,2-dimethylpropanoate |
| SMILES | CC1(C)CNc2c(cccc2S(=O)(=O)N[C@@H](CCCN/C(N)=N/[N+](=O)[O-])C(=O)N2CCC(CCOC(=O)C(C)(C)C)CC2)C1 |
| InChI | InChI=1S/C29H47N7O7S/c1-28(2,3)26(38)43-17-13-20-11-15-35(16-12-20)25(37)22(9-7-14-31-27(30)33-36(39)40)34-44(41,42)23-10-6-8-21-18-29(4,5)19-32-24(21)23/h6,8,10,20,22,32,34H,7,9,11-19H2,1-5H3,(H3,30,31,33)/t22-/m0/s1 |
| InChIKey | BMDYQTFGDCPZTC-QFIPXVFZSA-N |
| XLogP | 2.42 |
| TPSA | 198.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.80 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|