C44H50N4O7 — CID 135480449
methyl 3-[10-(3,5-dimethoxyphenyl)-8,13-diethyl-7-hydroxy-18-(3-methoxy-3-oxopropyl)-3,8,12,17-tetramethyl-22H-porphyrin-2-yl]propanoate (PubChem CID 135480449) has the molecular formula C44H50N4O7 and a molecular weight of 746.90 g/mol. Its IUPAC name is methyl 3-[10-(3,5-dimethoxyphenyl)-8,13-diethyl-7-hydroxy-18-(3-methoxy-3-oxopropyl)-3,8,12,17-tetramethyl-22H-porphyrin-2-yl]propanoate.
| Compound Name | methyl 3-[10-(3,5-dimethoxyphenyl)-8,13-diethyl-7-hydroxy-18-(3-methoxy-3-oxopropyl)-3,8,12,17-tetramethyl-22H-porphyrin-2-yl]propanoate |
|---|---|
| PubChem CID | 135480449 |
| Molecular Formula | C44H50N4O7 |
| Molecular Weight | 746.90 g/mol |
| Exact Mass | 746.37 |
| IUPAC Name | methyl 3-[10-(3,5-dimethoxyphenyl)-8,13-diethyl-7-hydroxy-18-(3-methoxy-3-oxopropyl)-3,8,12,17-tetramethyl-22H-porphyrin-2-yl]propanoate |
| SMILES | CCC1=C(C)C2=N/C1=C\C1=N/C(=C\C3=N/C(=C\C4=C(O)C(C)(CC)/C(=C/2c2cc(OC)cc(OC)c2)N4)C(C)=C3CCC(=O)OC)C(CCC(=O)OC)=C1C |
| InChI | InChI=1S/C44H50N4O7/c1-11-29-25(5)41-40(26-17-27(52-7)19-28(18-26)53-8)42-44(6,12-2)43(51)37(48-42)21-33-24(4)31(14-16-39(50)55-10)36(46-33)22-35-30(13-15-38(49)54-9)23(3)32(45-35)20-34(29)47-41/h17-22,48,51H,11-16H2,1-10H3/b33-21-,34-20-,35-22-,42-40- |
| InChIKey | KZLAGKXGWPYHPG-OBKAAZOQSA-N |
| XLogP | 8.50 |
| TPSA | 140.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.90 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |