C11H13N5O — CID 135480555
azanium [(3E,5Z)-7-amino-2,6-dicyano-3-ethyl-7-oxohepta-1,3,5-trienylidene]azanide (PubChem CID 135480555) has the molecular formula C11H13N5O and a molecular weight of 231.26 g/mol. Its IUPAC name is azanium [(3E,5Z)-7-amino-2,6-dicyano-3-ethyl-7-oxohepta-1,3,5-trienylidene]azanide.
| Compound Name | azanium [(3E,5Z)-7-amino-2,6-dicyano-3-ethyl-7-oxohepta-1,3,5-trienylidene]azanide |
|---|---|
| PubChem CID | 135480555 |
| Molecular Formula | C11H13N5O |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | azanium [(3E,5Z)-7-amino-2,6-dicyano-3-ethyl-7-oxohepta-1,3,5-trienylidene]azanide |
| SMILES | CC/C(=C\C=C(\C#N)C(N)=O)C(=C=[N-])C#N.[NH4+] |
| InChI | InChI=1S/C11H9N4O.H3N/c1-2-8(10(6-13)7-14)3-4-9(5-12)11(15)16;/h3-4H,2H2,1H3,(H2,15,16);1H3/q-1;/p+1/b8-3+,9-4-; |
| InChIKey | PHBCOGGYRPLDNY-XUFAXXPRSA-O |
| XLogP | 1.32 |
| TPSA | 149.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|