About 2-amino-4-(3,4-dichlorophenyl)-5-iodo-1H-pyrimidin-6-one
2-amino-4-(3,4-dichlorophenyl)-5-iodo-1H-pyrimidin-6-one (PubChem CID 135480649) has the molecular formula C10H6Cl2IN3O
and a molecular weight of 381.99 g/mol. Its IUPAC name is 2-amino-4-(3,4-dichlorophenyl)-5-iodo-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 2-amino-4-(3,4-dichlorophenyl)-5-iodo-1H-pyrimidin-6-one |
| PubChem CID | 135480649 |
| Molecular Formula | C10H6Cl2IN3O |
| Molecular Weight | 381.99 g/mol |
| Exact Mass | 380.89 |
| IUPAC Name | 2-amino-4-(3,4-dichlorophenyl)-5-iodo-1H-pyrimidin-6-one |
| SMILES | Nc1nc(-c2ccc(Cl)c(Cl)c2)c(I)c(=O)[nH]1 |
| InChI | InChI=1S/C10H6Cl2IN3O/c11-5-2-1-4(3-6(5)12)8-7(13)9(17)16-10(14)15-8/h1-3H,(H3,14,15,16,17) |
| InChIKey | WHIPVDKQSLVZDI-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.99 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4-(3,4-dichlorophenyl)-5-iodo-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-(3,4-dichlorophenyl)-5-iodo-1H-pyrimidin-6-one?
The IUPAC name of 2-amino-4-(3,4-dichlorophenyl)-5-iodo-1H-pyrimidin-6-one (CID 135480649) is 2-amino-4-(3,4-dichlorophenyl)-5-iodo-1H-pyrimidin-6-one.
What is the SMILES notation for 2-amino-4-(3,4-dichlorophenyl)-5-iodo-1H-pyrimidin-6-one?
The canonical SMILES for 2-amino-4-(3,4-dichlorophenyl)-5-iodo-1H-pyrimidin-6-one is Nc1nc(-c2ccc(Cl)c(Cl)c2)c(I)c(=O)[nH]1.
What is the InChIKey of 2-amino-4-(3,4-dichlorophenyl)-5-iodo-1H-pyrimidin-6-one?
The InChIKey is WHIPVDKQSLVZDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6Cl2IN3O/c11-5-2-1-4(3-6(5)12)8-7(13)9(17)16-10(14)15-8/h1-3H,(H3,14,15,16,17).
What are the key properties of 2-amino-4-(3,4-dichlorophenyl)-5-iodo-1H-pyrimidin-6-one?
2-amino-4-(3,4-dichlorophenyl)-5-iodo-1H-pyrimidin-6-one has a molecular weight of 381.99 g/mol, XLogP of 2.93, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-(3,4-dichlorophenyl)-5-iodo-1H-pyrimidin-6-one is sourced from PubChem (CID 135480649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).