C18H15ClFN3OS — CID 135480835
5-[(3-chlorophenyl)methyl]-2-[1-(4-fluorophenyl)ethylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 135480835) has the molecular formula C18H15ClFN3OS and a molecular weight of 375.86 g/mol. Its IUPAC name is 5-[(3-chlorophenyl)methyl]-2-[1-(4-fluorophenyl)ethylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | 5-[(3-chlorophenyl)methyl]-2-[1-(4-fluorophenyl)ethylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135480835 |
| Molecular Formula | C18H15ClFN3OS |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | 5-[(3-chlorophenyl)methyl]-2-[1-(4-fluorophenyl)ethylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | CC(=NN=C1NC(=O)C(Cc2cccc(Cl)c2)S1)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H15ClFN3OS/c1-11(13-5-7-15(20)8-6-13)22-23-18-21-17(24)16(25-18)10-12-3-2-4-14(19)9-12/h2-9,16H,10H2,1H3,(H,21,23,24) |
| InChIKey | UEFSTJZORAACHQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|