C20H20ClN3O2S — CID 135480970
2-[2-(4-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(2,3-dimethylphenyl)acetamide (PubChem CID 135480970) has the molecular formula C20H20ClN3O2S and a molecular weight of 401.92 g/mol. Its IUPAC name is 2-[2-(4-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(2,3-dimethylphenyl)acetamide.
| Compound Name | 2-[2-(4-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(2,3-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 135480970 |
| Molecular Formula | C20H20ClN3O2S |
| Molecular Weight | 401.92 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | 2-[2-(4-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(2,3-dimethylphenyl)acetamide |
| SMILES | Cc1cc(Cl)ccc1/N=C1/NC(=O)C(CC(=O)Nc2cccc(C)c2C)S1 |
| InChI | InChI=1S/C20H20ClN3O2S/c1-11-5-4-6-16(13(11)3)22-18(25)10-17-19(26)24-20(27-17)23-15-8-7-14(21)9-12(15)2/h4-9,17H,10H2,1-3H3,(H,22,25)(H,23,24,26) |
| InChIKey | FGPYOZLLFBGZHI-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.92 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|