C12H10N4S — CID 135481940
1-benzyl-7H-pyrazolo[5,4-d]pyrimidine-4-thione (PubChem CID 135481940) has the molecular formula C12H10N4S and a molecular weight of 242.31 g/mol. Its IUPAC name is 1-benzyl-7H-pyrazolo[5,4-d]pyrimidine-4-thione.
| Compound Name | 1-benzyl-7H-pyrazolo[5,4-d]pyrimidine-4-thione |
|---|---|
| PubChem CID | 135481940 |
| Molecular Formula | C12H10N4S |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 1-benzyl-7H-pyrazolo[5,4-d]pyrimidine-4-thione |
| SMILES | S=c1nc[nH]c2c1cnn2Cc1ccccc1 |
| InChI | InChI=1S/C12H10N4S/c17-12-10-6-15-16(11(10)13-8-14-12)7-9-4-2-1-3-5-9/h1-6,8H,7H2,(H,13,14,17) |
| InChIKey | SLCUJURZNGAVEX-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|