C20H10N2O5 — CID 135482345
12-hydroxy-17,24-dioxa-3,13-diazahexacyclo[14.8.0.02,10.04,9.011,15.018,23]tetracosa-1,4,7,9,11,15,18,20,22-nonaene-6,14-dione (PubChem CID 135482345) has the molecular formula C20H10N2O5 and a molecular weight of 358.31 g/mol. Its IUPAC name is 12-hydroxy-17,24-dioxa-3,13-diazahexacyclo[14.8.0.02,10.04,9.011,15.018,23]tetracosa-1,4,7,9,11,15,18,20,22-nonaene-6,14-dione.
| Compound Name | 12-hydroxy-17,24-dioxa-3,13-diazahexacyclo[14.8.0.02,10.04,9.011,15.018,23]tetracosa-1,4,7,9,11,15,18,20,22-nonaene-6,14-dione |
|---|---|
| PubChem CID | 135482345 |
| Molecular Formula | C20H10N2O5 |
| Molecular Weight | 358.31 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 12-hydroxy-17,24-dioxa-3,13-diazahexacyclo[14.8.0.02,10.04,9.011,15.018,23]tetracosa-1,4,7,9,11,15,18,20,22-nonaene-6,14-dione |
| SMILES | O=c1ccc2c(c1)[nH]c1c3oc4ccccc4oc3c3c(=O)[nH]c(O)c3c21 |
| InChI | InChI=1S/C20H10N2O5/c23-8-5-6-9-10(7-8)21-16-13(9)14-15(20(25)22-19(14)24)17-18(16)27-12-4-2-1-3-11(12)26-17/h1-7,21,24H,(H,22,25) |
| InChIKey | JMMLOESQFODGPP-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 112.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.31 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|