C18H13BrN4S2 — CID 135482360
13-(4-bromophenyl)-11-methyl-16-thia-3,6,8,14-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1,8,10(15),11,13-pentaene-7-thione (PubChem CID 135482360) has the molecular formula C18H13BrN4S2 and a molecular weight of 429.37 g/mol. Its IUPAC name is 13-(4-bromophenyl)-11-methyl-16-thia-3,6,8,14-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1,8,10(15),11,13-pentaene-7-thione.
| Compound Name | 13-(4-bromophenyl)-11-methyl-16-thia-3,6,8,14-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1,8,10(15),11,13-pentaene-7-thione |
|---|---|
| PubChem CID | 135482360 |
| Molecular Formula | C18H13BrN4S2 |
| Molecular Weight | 429.37 g/mol |
| Exact Mass | 427.98 |
| IUPAC Name | 13-(4-bromophenyl)-11-methyl-16-thia-3,6,8,14-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1,8,10(15),11,13-pentaene-7-thione |
| SMILES | Cc1cc(-c2ccc(Br)cc2)nc2sc3c4n(c(=S)nc3c12)CCN4 |
| InChI | InChI=1S/C18H13BrN4S2/c1-9-8-12(10-2-4-11(19)5-3-10)21-17-13(9)14-15(25-17)16-20-6-7-23(16)18(24)22-14/h2-5,8,20H,6-7H2,1H3 |
| InChIKey | ABDLFBJKTJMYHV-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.37 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|