C18H22N4OS — CID 135482421
5-[1-(2-methoxyethyl)-2,5-dimethylpyrrol-3-yl]-N-phenyl-3,6-dihydro-1,3,4-thiadiazin-2-imine (PubChem CID 135482421) has the molecular formula C18H22N4OS and a molecular weight of 342.47 g/mol. Its IUPAC name is 5-[1-(2-methoxyethyl)-2,5-dimethylpyrrol-3-yl]-N-phenyl-3,6-dihydro-1,3,4-thiadiazin-2-imine.
| Compound Name | 5-[1-(2-methoxyethyl)-2,5-dimethylpyrrol-3-yl]-N-phenyl-3,6-dihydro-1,3,4-thiadiazin-2-imine |
|---|---|
| PubChem CID | 135482421 |
| Molecular Formula | C18H22N4OS |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 5-[1-(2-methoxyethyl)-2,5-dimethylpyrrol-3-yl]-N-phenyl-3,6-dihydro-1,3,4-thiadiazin-2-imine |
| SMILES | COCCn1c(C)cc(C2=NN/C(=N/c3ccccc3)SC2)c1C |
| InChI | InChI=1S/C18H22N4OS/c1-13-11-16(14(2)22(13)9-10-23-3)17-12-24-18(21-20-17)19-15-7-5-4-6-8-15/h4-8,11H,9-10,12H2,1-3H3,(H,19,21) |
| InChIKey | MHFCLIYPOZOCGJ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 50.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_urea_L(1)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|