C16H17N3O4S — CID 135482564
2-[2-[4-(4-methoxyphenyl)but-3-en-2-ylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 135482564) has the molecular formula C16H17N3O4S and a molecular weight of 347.40 g/mol. Its IUPAC name is 2-[2-[4-(4-methoxyphenyl)but-3-en-2-ylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[2-[4-(4-methoxyphenyl)but-3-en-2-ylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 135482564 |
| Molecular Formula | C16H17N3O4S |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 2-[2-[4-(4-methoxyphenyl)but-3-en-2-ylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | COc1ccc(C=CC(C)=NN=C2NC(=O)C(CC(=O)O)S2)cc1 |
| InChI | InChI=1S/C16H17N3O4S/c1-10(3-4-11-5-7-12(23-2)8-6-11)18-19-16-17-15(22)13(24-16)9-14(20)21/h3-8,13H,9H2,1-2H3,(H,20,21)(H,17,19,22) |
| InChIKey | CGHKPCWBDXTENE-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|