C19H16N2O5S — CID 135483130
4-[[2-(2,4-dimethoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]benzoic acid (PubChem CID 135483130) has the molecular formula C19H16N2O5S and a molecular weight of 384.41 g/mol. Its IUPAC name is 4-[[2-(2,4-dimethoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]benzoic acid.
| Compound Name | 4-[[2-(2,4-dimethoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 135483130 |
| Molecular Formula | C19H16N2O5S |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | 4-[[2-(2,4-dimethoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]benzoic acid |
| SMILES | COc1ccc(/N=C2/NC(=O)C(=Cc3ccc(C(=O)O)cc3)S2)c(OC)c1 |
| InChI | InChI=1S/C19H16N2O5S/c1-25-13-7-8-14(15(10-13)26-2)20-19-21-17(22)16(27-19)9-11-3-5-12(6-4-11)18(23)24/h3-10H,1-2H3,(H,23,24)(H,20,21,22) |
| InChIKey | LTVNZEDOMJVZLF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|