C19H16N2O5S — CID 135483203
2-[[5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid (PubChem CID 135483203) has the molecular formula C19H16N2O5S and a molecular weight of 384.41 g/mol. Its IUPAC name is 2-[[5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid.
| Compound Name | 2-[[5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 135483203 |
| Molecular Formula | C19H16N2O5S |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | 2-[[5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
| SMILES | CCOc1cc(C=C2S/C(=N\c3ccccc3C(=O)O)NC2=O)ccc1O |
| InChI | InChI=1S/C19H16N2O5S/c1-2-26-15-9-11(7-8-14(15)22)10-16-17(23)21-19(27-16)20-13-6-4-3-5-12(13)18(24)25/h3-10,22H,2H2,1H3,(H,24,25)(H,20,21,23) |
| InChIKey | TYNGCJXASWHBPX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 108.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|