C20H22N4O6S2 — CID 135483375
N-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl]-4-morpholin-4-ylsulfonylbenzamide (PubChem CID 135483375) has the molecular formula C20H22N4O6S2 and a molecular weight of 478.55 g/mol. Its IUPAC name is N-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl]-4-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl]-4-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 135483375 |
| Molecular Formula | C20H22N4O6S2 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | N-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl]-4-morpholin-4-ylsulfonylbenzamide |
| SMILES | O=C(NCC/N=C1\NS(=O)(=O)c2ccccc21)c1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C20H22N4O6S2/c25-20(15-5-7-16(8-6-15)32(28,29)24-11-13-30-14-12-24)22-10-9-21-19-17-3-1-2-4-18(17)31(26,27)23-19/h1-8H,9-14H2,(H,21,23)(H,22,25) |
| InChIKey | RZIPHGKOOYQOBY-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 134.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|