About 6-methylsulfanyl-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one
6-methylsulfanyl-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 135483440) has the molecular formula C6H6N4OS
and a molecular weight of 182.21 g/mol. Its IUPAC name is 6-methylsulfanyl-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 6-methylsulfanyl-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one |
| PubChem CID | 135483440 |
| Molecular Formula | C6H6N4OS |
| Molecular Weight | 182.21 g/mol |
| Exact Mass | 182.03 |
| IUPAC Name | 6-methylsulfanyl-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | CSc1nc2[nH]ncc2c(=O)[nH]1 |
| InChI | InChI=1S/C6H6N4OS/c1-12-6-8-4-3(2-7-10-4)5(11)9-6/h2H,1H3,(H2,7,8,9,10,11) |
| InChIKey | PDEMJBQWVFOIGO-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.21 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-methylsulfanyl-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylsulfanyl-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one?
The IUPAC name of 6-methylsulfanyl-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one (CID 135483440) is 6-methylsulfanyl-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one.
What is the SMILES notation for 6-methylsulfanyl-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one?
The canonical SMILES for 6-methylsulfanyl-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one is CSc1nc2[nH]ncc2c(=O)[nH]1.
What is the InChIKey of 6-methylsulfanyl-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one?
The InChIKey is PDEMJBQWVFOIGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4OS/c1-12-6-8-4-3(2-7-10-4)5(11)9-6/h2H,1H3,(H2,7,8,9,10,11).
What are the key properties of 6-methylsulfanyl-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one?
6-methylsulfanyl-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one has a molecular weight of 182.21 g/mol, XLogP of 0.37, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylsulfanyl-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one is sourced from PubChem (CID 135483440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).