C11H8O6 — CID 135483447
2,3,5,8-tetrahydroxy-6-methylnaphthalene-1,4-dione (PubChem CID 135483447) has the molecular formula C11H8O6 and a molecular weight of 236.18 g/mol. Its IUPAC name is 2,3,5,8-tetrahydroxy-6-methylnaphthalene-1,4-dione.
| Compound Name | 2,3,5,8-tetrahydroxy-6-methylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 135483447 |
| Molecular Formula | C11H8O6 |
| Molecular Weight | 236.18 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | 2,3,5,8-tetrahydroxy-6-methylnaphthalene-1,4-dione |
| SMILES | Cc1cc(O)c2c(c1O)C(=O)C(O)=C(O)C2=O |
| InChI | InChI=1S/C11H8O6/c1-3-2-4(12)5-6(7(3)13)9(15)11(17)10(16)8(5)14/h2,12-13,16-17H,1H3 |
| InChIKey | WXLPYHMWBMMBOS-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.18 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|