C22H15F3N2O5S — CID 135483449
4-hydroxy-6-methyl-3-[2-(3-nitrophenyl)-7-(trifluoromethyl)-2,3-dihydro-1,5-benzothiazepin-4-yl]pyran-2-one (PubChem CID 135483449) has the molecular formula C22H15F3N2O5S and a molecular weight of 476.43 g/mol. Its IUPAC name is 4-hydroxy-6-methyl-3-[2-(3-nitrophenyl)-7-(trifluoromethyl)-2,3-dihydro-1,5-benzothiazepin-4-yl]pyran-2-one.
| Compound Name | 4-hydroxy-6-methyl-3-[2-(3-nitrophenyl)-7-(trifluoromethyl)-2,3-dihydro-1,5-benzothiazepin-4-yl]pyran-2-one |
|---|---|
| PubChem CID | 135483449 |
| Molecular Formula | C22H15F3N2O5S |
| Molecular Weight | 476.43 g/mol |
| Exact Mass | 476.07 |
| IUPAC Name | 4-hydroxy-6-methyl-3-[2-(3-nitrophenyl)-7-(trifluoromethyl)-2,3-dihydro-1,5-benzothiazepin-4-yl]pyran-2-one |
| SMILES | Cc1cc(O)c(C2=Nc3cc(C(F)(F)F)ccc3SC(c3cccc([N+](=O)[O-])c3)C2)c(=O)o1 |
| InChI | InChI=1S/C22H15F3N2O5S/c1-11-7-17(28)20(21(29)32-11)16-10-19(12-3-2-4-14(8-12)27(30)31)33-18-6-5-13(22(23,24)25)9-15(18)26-16/h2-9,19,28H,10H2,1H3 |
| InChIKey | TUZVYQDYGIFYJY-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 105.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.43 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|