C47H30N4O6 — CID 135483732
4-[10,15-bis(4-carboxyphenyl)-20-phenyl-21,23-dihydroporphyrin-5-yl]benzoic acid (PubChem CID 135483732) has the molecular formula C47H30N4O6 and a molecular weight of 746.78 g/mol. Its IUPAC name is 4-[10,15-bis(4-carboxyphenyl)-20-phenyl-21,23-dihydroporphyrin-5-yl]benzoic acid.
| Compound Name | 4-[10,15-bis(4-carboxyphenyl)-20-phenyl-21,23-dihydroporphyrin-5-yl]benzoic acid |
|---|---|
| PubChem CID | 135483732 |
| Molecular Formula | C47H30N4O6 |
| Molecular Weight | 746.78 g/mol |
| Exact Mass | 746.22 |
| IUPAC Name | 4-[10,15-bis(4-carboxyphenyl)-20-phenyl-21,23-dihydroporphyrin-5-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2c3nc(c(-c4ccc(C(=O)O)cc4)c4ccc([nH]4)c(-c4ccc(C(=O)O)cc4)c4nc(c(-c5ccccc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C47H30N4O6/c52-45(53)30-12-6-27(7-13-30)42-35-20-18-33(48-35)41(26-4-2-1-3-5-26)34-19-21-36(49-34)43(28-8-14-31(15-9-28)46(54)55)38-23-25-40(51-38)44(39-24-22-37(42)50-39)29-10-16-32(17-11-29)47(56)57/h1-25,48,51H,(H,52,53)(H,54,55)(H,56,57)/b41-33-,41-34-,42-35-,42-37-,43-36-,43-38-,44-39-,44-40- |
| InChIKey | QPDSWEHRIINIFR-LWQDQPMZSA-N |
| XLogP | 10.42 |
| TPSA | 169.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.78 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |