C17H21N5O6S2 — CID 135483994
(2S)-2-[[5-[3-[(2,4-diamino-6-oxo-1H-pyrimidin-5-yl)sulfanyl]propyl]thiophene-2-carbonyl]amino]pentanedioic acid (PubChem CID 135483994) has the molecular formula C17H21N5O6S2 and a molecular weight of 455.52 g/mol. Its IUPAC name is (2S)-2-[[5-[3-[(2,4-diamino-6-oxo-1H-pyrimidin-5-yl)sulfanyl]propyl]thiophene-2-carbonyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[5-[3-[(2,4-diamino-6-oxo-1H-pyrimidin-5-yl)sulfanyl]propyl]thiophene-2-carbonyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 135483994 |
| Molecular Formula | C17H21N5O6S2 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.09 |
| IUPAC Name | (2S)-2-[[5-[3-[(2,4-diamino-6-oxo-1H-pyrimidin-5-yl)sulfanyl]propyl]thiophene-2-carbonyl]amino]pentanedioic acid |
| SMILES | Nc1nc(N)c(SCCCc2ccc(C(=O)N[C@@H](CCC(=O)O)C(=O)O)s2)c(=O)[nH]1 |
| InChI | InChI=1S/C17H21N5O6S2/c18-13-12(15(26)22-17(19)21-13)29-7-1-2-8-3-5-10(30-8)14(25)20-9(16(27)28)4-6-11(23)24/h3,5,9H,1-2,4,6-7H2,(H,20,25)(H,23,24)(H,27,28)(H5,18,19,21,22,26)/t9-/m0/s1 |
| InChIKey | NQIQMFMYULMMGE-VIFPVBQESA-N |
| XLogP | 0.77 |
| TPSA | 201.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|