About 6-ethoxy-1,4-dioxido-3-phenylquinoxaline-1,4-diium-2-amine
6-ethoxy-1,4-dioxido-3-phenylquinoxaline-1,4-diium-2-amine (PubChem CID 135484666) has the molecular formula C16H15N3O3
and a molecular weight of 297.31 g/mol. Its IUPAC name is 6-ethoxy-1,4-dioxido-3-phenylquinoxaline-1,4-diium-2-amine.
Molecular Properties
| Compound Name | 6-ethoxy-1,4-dioxido-3-phenylquinoxaline-1,4-diium-2-amine |
| PubChem CID | 135484666 |
| Molecular Formula | C16H15N3O3 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 6-ethoxy-1,4-dioxido-3-phenylquinoxaline-1,4-diium-2-amine |
| SMILES | CCOc1ccc2c(c1)[n+]([O-])c(-c1ccccc1)c(N)[n+]2[O-] |
| InChI | InChI=1S/C16H15N3O3/c1-2-22-12-8-9-13-14(10-12)18(20)15(16(17)19(13)21)11-6-4-3-5-7-11/h3-10H,2,17H2,1H3 |
| InChIKey | CKJUHUTZEWGZCS-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 6-ethoxy-1,4-dioxido-3-phenylquinoxaline-1,4-diium-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethoxy-1,4-dioxido-3-phenylquinoxaline-1,4-diium-2-amine?
The IUPAC name of 6-ethoxy-1,4-dioxido-3-phenylquinoxaline-1,4-diium-2-amine (CID 135484666) is 6-ethoxy-1,4-dioxido-3-phenylquinoxaline-1,4-diium-2-amine.
What is the SMILES notation for 6-ethoxy-1,4-dioxido-3-phenylquinoxaline-1,4-diium-2-amine?
The canonical SMILES for 6-ethoxy-1,4-dioxido-3-phenylquinoxaline-1,4-diium-2-amine is CCOc1ccc2c(c1)[n+]([O-])c(-c1ccccc1)c(N)[n+]2[O-].
What is the InChIKey of 6-ethoxy-1,4-dioxido-3-phenylquinoxaline-1,4-diium-2-amine?
The InChIKey is CKJUHUTZEWGZCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N3O3/c1-2-22-12-8-9-13-14(10-12)18(20)15(16(17)19(13)21)11-6-4-3-5-7-11/h3-10H,2,17H2,1H3.
What are the key properties of 6-ethoxy-1,4-dioxido-3-phenylquinoxaline-1,4-diium-2-amine?
6-ethoxy-1,4-dioxido-3-phenylquinoxaline-1,4-diium-2-amine has a molecular weight of 297.31 g/mol, XLogP of 1.75, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethoxy-1,4-dioxido-3-phenylquinoxaline-1,4-diium-2-amine is sourced from PubChem (CID 135484666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).