C26H22N6NiO4 — CID 135484770
(NE,1E)-2-hydroxy-N-(pyridin-2-ylmethylidene)benzenecarbohydrazonic acid;(NE,1Z)-2-hydroxy-N-(pyridin-2-ylmethylidene)benzenecarbohydrazonic acid;nickel (PubChem CID 135484770) has the molecular formula C26H22N6NiO4 and a molecular weight of 541.19 g/mol. Its IUPAC name is (NE,1E)-2-hydroxy-N-(pyridin-2-ylmethylidene)benzenecarbohydrazonic acid;(NE,1Z)-2-hydroxy-N-(pyridin-2-ylmethylidene)benzenecarbohydrazonic acid;nickel.
| Compound Name | (NE,1E)-2-hydroxy-N-(pyridin-2-ylmethylidene)benzenecarbohydrazonic acid;(NE,1Z)-2-hydroxy-N-(pyridin-2-ylmethylidene)benzenecarbohydrazonic acid;nickel |
|---|---|
| PubChem CID | 135484770 |
| Molecular Formula | C26H22N6NiO4 |
| Molecular Weight | 541.19 g/mol |
| Exact Mass | 540.11 |
| IUPAC Name | (NE,1E)-2-hydroxy-N-(pyridin-2-ylmethylidene)benzenecarbohydrazonic acid;(NE,1Z)-2-hydroxy-N-(pyridin-2-ylmethylidene)benzenecarbohydrazonic acid;nickel |
| SMILES | O/C(=N/N=C/c1ccccn1)c1ccccc1O.O/C(=N\N=C\c1ccccn1)c1ccccc1O.[Ni] |
| InChI | InChI=1S/2C13H11N3O2.Ni/c2*17-12-7-2-1-6-11(12)13(18)16-15-9-10-5-3-4-8-14-10;/h2*1-9,17H,(H,16,18);/b2*15-9+; |
| InChIKey | AMBIJEWEWUSILW-CGZWKZIFSA-N |
| XLogP | 4.25 |
| TPSA | 156.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.19 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|