C44H30N4Zn — CID 135484857
5,10,15,20-tetraphenyl-21,23-dihydroporphyrin;zinc (PubChem CID 135484857) has the molecular formula C44H30N4Zn and a molecular weight of 680.14 g/mol. Its IUPAC name is 5,10,15,20-tetraphenyl-21,23-dihydroporphyrin;zinc.
| Compound Name | 5,10,15,20-tetraphenyl-21,23-dihydroporphyrin;zinc |
|---|---|
| PubChem CID | 135484857 |
| Molecular Formula | C44H30N4Zn |
| Molecular Weight | 680.14 g/mol |
| Exact Mass | 678.18 |
| IUPAC Name | 5,10,15,20-tetraphenyl-21,23-dihydroporphyrin;zinc |
| SMILES | C1=Cc2nc1c(-c1ccccc1)c1ccc([nH]1)c(-c1ccccc1)c1nc(c(-c3ccccc3)c3ccc([nH]3)c2-c2ccccc2)C=C1.[Zn] |
| InChI | InChI=1S/C44H30N4.Zn/c1-5-13-29(14-6-1)41-33-21-23-35(45-33)42(30-15-7-2-8-16-30)37-25-27-39(47-37)44(32-19-11-4-12-20-32)40-28-26-38(48-40)43(31-17-9-3-10-18-31)36-24-22-34(41)46-36;/h1-28,45,48H;/b41-33-,41-34-,42-35-,42-37-,43-36-,43-38-,44-39-,44-40-; |
| InChIKey | GTZCNONABJSHNM-DAJBKUBHSA-N |
| XLogP | 11.32 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.14 |
| LogP ≤ 5 | 11.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|